C6H10 — CID 16698025
cis-(1R,2S)-1-(2-deuterioethenyl)-2-methylcyclopropane (PubChem CID 16698025) has the molecular formula C6H10 and a molecular weight of 83.15 g/mol. Its IUPAC name is cis-(1R,2S)-1-(2-deuterioethenyl)-2-methylcyclopropane.
| Compound Name | cis-(1R,2S)-1-(2-deuterioethenyl)-2-methylcyclopropane |
|---|---|
| PubChem CID | 16698025 |
| Molecular Formula | C6H10 |
| Molecular Weight | 83.15 g/mol |
| Exact Mass | 83.08 |
| IUPAC Name | cis-(1R,2S)-1-(2-deuterioethenyl)-2-methylcyclopropane |
| SMILES | [2H]/C=C/[C@H]1C[C@@H]1C |
| InChI | InChI=1S/C6H10/c1-3-6-4-5(6)2/h3,5-6H,1,4H2,2H3/t5-,6-/m0/s1/i1D/b3-1+ |
| InChIKey | JVVPJIPOOZHNTM-CIPBKBJBSA-N |
| XLogP | 1.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 83.15 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|