2-[(1R,2S,3S)-2-ethenyl-3-methylcyclopentyl]prop-2-enoic acid

C11H16O2 — CID 102585587

IUPAC2-[(1R,2S,3S)-2-ethenyl-3-methylcyclopentyl]prop-2-enoic acid
SMILESC=C[C@H]1[C@@H](C)CC[C@H]1C(=C)C(=O)O
InChIInChI=1S/C11H16O2/c1-4-9-7(2)5-6-10(9)8(3)11(12)13/h4,7,9-10H,1,3,5-6H2,2H3,(H,12,13)/t7-,9-,10-/m0/s1
InChIKeySCNOPDFNSBZTES-HGNGGELXSA-N
MW180.25 g/mol
LogP2.48
Rot. Bonds3

About 2-[(1R,2S,3S)-2-ethenyl-3-methylcyclopentyl]prop-2-enoic acid

2-[(1R,2S,3S)-2-ethenyl-3-methylcyclopentyl]prop-2-enoic acid (PubChem CID 102585587) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-[(1R,2S,3S)-2-ethenyl-3-methylcyclopentyl]prop-2-enoic acid.

Molecular Properties

Compound Name2-[(1R,2S,3S)-2-ethenyl-3-methylcyclopentyl]prop-2-enoic acid
PubChem CID102585587
Molecular FormulaC11H16O2
Molecular Weight180.25 g/mol
Exact Mass180.12
IUPAC Name2-[(1R,2S,3S)-2-ethenyl-3-methylcyclopentyl]prop-2-enoic acid
SMILESC=C[C@H]1[C@@H](C)CC[C@H]1C(=C)C(=O)O
InChIInChI=1S/C11H16O2/c1-4-9-7(2)5-6-10(9)8(3)11(12)13/h4,7,9-10H,1,3,5-6H2,2H3,(H,12,13)/t7-,9-,10-/m0/s1
InChIKeySCNOPDFNSBZTES-HGNGGELXSA-N
XLogP2.48
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.25
LogP ≤ 52.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-[(1R,2S,3S)-2-ethenyl-3-methylcyclopentyl]prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1R,2S,3S)-2-ethenyl-3-methylcyclopentyl]prop-2-enoic acid?
The IUPAC name of 2-[(1R,2S,3S)-2-ethenyl-3-methylcyclopentyl]prop-2-enoic acid (CID 102585587) is 2-[(1R,2S,3S)-2-ethenyl-3-methylcyclopentyl]prop-2-enoic acid.
What is the SMILES notation for 2-[(1R,2S,3S)-2-ethenyl-3-methylcyclopentyl]prop-2-enoic acid?
The canonical SMILES for 2-[(1R,2S,3S)-2-ethenyl-3-methylcyclopentyl]prop-2-enoic acid is C=C[C@H]1[C@@H](C)CC[C@H]1C(=C)C(=O)O.
What is the InChIKey of 2-[(1R,2S,3S)-2-ethenyl-3-methylcyclopentyl]prop-2-enoic acid?
The InChIKey is SCNOPDFNSBZTES-HGNGGELXSA-N. The full InChI is InChI=1S/C11H16O2/c1-4-9-7(2)5-6-10(9)8(3)11(12)13/h4,7,9-10H,1,3,5-6H2,2H3,(H,12,13)/t7-,9-,10-/m0/s1.
What are the key properties of 2-[(1R,2S,3S)-2-ethenyl-3-methylcyclopentyl]prop-2-enoic acid?
2-[(1R,2S,3S)-2-ethenyl-3-methylcyclopentyl]prop-2-enoic acid has a molecular weight of 180.25 g/mol, XLogP of 2.48, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,2S,3S)-2-ethenyl-3-methylcyclopentyl]prop-2-enoic acid is sourced from PubChem (CID 102585587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).