C12H18O4 — CID 90121753
2-[(2,6-dimethylcyclohexyl)methylidene]propanedioic acid (PubChem CID 90121753) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 2-[(2,6-dimethylcyclohexyl)methylidene]propanedioic acid.
| Compound Name | 2-[(2,6-dimethylcyclohexyl)methylidene]propanedioic acid |
|---|---|
| PubChem CID | 90121753 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2-[(2,6-dimethylcyclohexyl)methylidene]propanedioic acid |
| SMILES | CC1CCCC(C)C1C=C(C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H18O4/c1-7-4-3-5-8(2)9(7)6-10(11(13)14)12(15)16/h6-9H,3-5H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | JTEINEOWBASSEM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|