C15H18O6 — CID 69265737
2-[3,4-bis(1-carboxyethenyl)cyclohexyl]prop-2-enoic acid (PubChem CID 69265737) has the molecular formula C15H18O6 and a molecular weight of 294.30 g/mol. Its IUPAC name is 2-[3,4-bis(1-carboxyethenyl)cyclohexyl]prop-2-enoic acid.
| Compound Name | 2-[3,4-bis(1-carboxyethenyl)cyclohexyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 69265737 |
| Molecular Formula | C15H18O6 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 2-[3,4-bis(1-carboxyethenyl)cyclohexyl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)C1CCC(C(=C)C(=O)O)C(C(=C)C(=O)O)C1 |
| InChI | InChI=1S/C15H18O6/c1-7(13(16)17)10-4-5-11(8(2)14(18)19)12(6-10)9(3)15(20)21/h10-12H,1-6H2,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | VEHWNXAEUHFSIE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|