About N-cyclohexylcyclohexanamine;2-cyclopropylprop-2-enoic acid;nitrous acid
N-cyclohexylcyclohexanamine;2-cyclopropylprop-2-enoic acid;nitrous acid (PubChem CID 173401529) has the molecular formula C18H32N2O4
and a molecular weight of 340.46 g/mol. Its IUPAC name is N-cyclohexylcyclohexanamine;2-cyclopropylprop-2-enoic acid;nitrous acid.
Molecular Properties
| Compound Name | N-cyclohexylcyclohexanamine;2-cyclopropylprop-2-enoic acid;nitrous acid |
| PubChem CID | 173401529 |
| Molecular Formula | C18H32N2O4 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | N-cyclohexylcyclohexanamine;2-cyclopropylprop-2-enoic acid;nitrous acid |
| SMILES | C1CCC(NC2CCCCC2)CC1.C=C(C(=O)O)C1CC1.O=NO |
| InChI | InChI=1S/C12H23N.C6H8O2.HNO2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-4(6(7)8)5-2-3-5;2-1-3/h11-13H,1-10H2;5H,1-3H2,(H,7,8);(H,2,3) |
| InChIKey | BZMDYMSDRBWMEK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexylcyclohexanamine;2-cyclopropylprop-2-enoic acid;nitrous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexylcyclohexanamine;2-cyclopropylprop-2-enoic acid;nitrous acid?
The IUPAC name of N-cyclohexylcyclohexanamine;2-cyclopropylprop-2-enoic acid;nitrous acid (CID 173401529) is N-cyclohexylcyclohexanamine;2-cyclopropylprop-2-enoic acid;nitrous acid.
What is the SMILES notation for N-cyclohexylcyclohexanamine;2-cyclopropylprop-2-enoic acid;nitrous acid?
The canonical SMILES for N-cyclohexylcyclohexanamine;2-cyclopropylprop-2-enoic acid;nitrous acid is C1CCC(NC2CCCCC2)CC1.C=C(C(=O)O)C1CC1.O=NO.
What is the InChIKey of N-cyclohexylcyclohexanamine;2-cyclopropylprop-2-enoic acid;nitrous acid?
The InChIKey is BZMDYMSDRBWMEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N.C6H8O2.HNO2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-4(6(7)8)5-2-3-5;2-1-3/h11-13H,1-10H2;5H,1-3H2,(H,7,8);(H,2,3).
What are the key properties of N-cyclohexylcyclohexanamine;2-cyclopropylprop-2-enoic acid;nitrous acid?
N-cyclohexylcyclohexanamine;2-cyclopropylprop-2-enoic acid;nitrous acid has a molecular weight of 340.46 g/mol, XLogP of 4.42, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexylcyclohexanamine;2-cyclopropylprop-2-enoic acid;nitrous acid is sourced from PubChem (CID 173401529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).