cycloheptylhydrazine;oxalic acid

C9H18N2O4 — CID 24838802

IUPACcycloheptylhydrazine;oxalic acid
SMILESNNC1CCCCCC1.O=C(O)C(=O)O
InChIInChI=1S/C7H16N2.C2H2O4/c8-9-7-5-3-1-2-4-6-7;3-1(4)2(5)6/h7,9H,1-6,8H2;(H,3,4)(H,5,6)
InChIKeyORMABJQLGNQYII-UHFFFAOYSA-N
MW218.25 g/mol
LogP0.33
Rot. Bonds1

About cycloheptylhydrazine;oxalic acid

cycloheptylhydrazine;oxalic acid (PubChem CID 24838802) has the molecular formula C9H18N2O4 and a molecular weight of 218.25 g/mol. Its IUPAC name is cycloheptylhydrazine;oxalic acid.

Molecular Properties

Compound Namecycloheptylhydrazine;oxalic acid
PubChem CID24838802
Molecular FormulaC9H18N2O4
Molecular Weight218.25 g/mol
Exact Mass218.13
IUPAC Namecycloheptylhydrazine;oxalic acid
SMILESNNC1CCCCCC1.O=C(O)C(=O)O
InChIInChI=1S/C7H16N2.C2H2O4/c8-9-7-5-3-1-2-4-6-7;3-1(4)2(5)6/h7,9H,1-6,8H2;(H,3,4)(H,5,6)
InChIKeyORMABJQLGNQYII-UHFFFAOYSA-N
XLogP0.33
TPSA112.65 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.25
LogP ≤ 50.33
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze cycloheptylhydrazine;oxalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cycloheptylhydrazine;oxalic acid?
The IUPAC name of cycloheptylhydrazine;oxalic acid (CID 24838802) is cycloheptylhydrazine;oxalic acid.
What is the SMILES notation for cycloheptylhydrazine;oxalic acid?
The canonical SMILES for cycloheptylhydrazine;oxalic acid is NNC1CCCCCC1.O=C(O)C(=O)O.
What is the InChIKey of cycloheptylhydrazine;oxalic acid?
The InChIKey is ORMABJQLGNQYII-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2.C2H2O4/c8-9-7-5-3-1-2-4-6-7;3-1(4)2(5)6/h7,9H,1-6,8H2;(H,3,4)(H,5,6).
What are the key properties of cycloheptylhydrazine;oxalic acid?
cycloheptylhydrazine;oxalic acid has a molecular weight of 218.25 g/mol, XLogP of 0.33, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cycloheptylhydrazine;oxalic acid is sourced from PubChem (CID 24838802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).