3-hydrazinylpiperidine-1-carboxylic acid

C6H13N3O2 — CID 126736285

IUPAC3-hydrazinylpiperidine-1-carboxylic acid
SMILESNNC1CCCN(C(=O)O)C1
InChIInChI=1S/C6H13N3O2/c7-8-5-2-1-3-9(4-5)6(10)11/h5,8H,1-4,7H2,(H,10,11)
InChIKeyFFYSZICMTBBSAA-UHFFFAOYSA-N
MW159.19 g/mol
LogP-0.41
Rot. Bonds1

About 3-hydrazinylpiperidine-1-carboxylic acid

3-hydrazinylpiperidine-1-carboxylic acid (PubChem CID 126736285) has the molecular formula C6H13N3O2 and a molecular weight of 159.19 g/mol. Its IUPAC name is 3-hydrazinylpiperidine-1-carboxylic acid.

Molecular Properties

Compound Name3-hydrazinylpiperidine-1-carboxylic acid
PubChem CID126736285
Molecular FormulaC6H13N3O2
Molecular Weight159.19 g/mol
Exact Mass159.10
IUPAC Name3-hydrazinylpiperidine-1-carboxylic acid
SMILESNNC1CCCN(C(=O)O)C1
InChIInChI=1S/C6H13N3O2/c7-8-5-2-1-3-9(4-5)6(10)11/h5,8H,1-4,7H2,(H,10,11)
InChIKeyFFYSZICMTBBSAA-UHFFFAOYSA-N
XLogP-0.41
TPSA78.59 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500159.19
LogP ≤ 5-0.41
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 3-hydrazinylpiperidine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-hydrazinylpiperidine-1-carboxylic acid?
The IUPAC name of 3-hydrazinylpiperidine-1-carboxylic acid (CID 126736285) is 3-hydrazinylpiperidine-1-carboxylic acid.
What is the SMILES notation for 3-hydrazinylpiperidine-1-carboxylic acid?
The canonical SMILES for 3-hydrazinylpiperidine-1-carboxylic acid is NNC1CCCN(C(=O)O)C1.
What is the InChIKey of 3-hydrazinylpiperidine-1-carboxylic acid?
The InChIKey is FFYSZICMTBBSAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3O2/c7-8-5-2-1-3-9(4-5)6(10)11/h5,8H,1-4,7H2,(H,10,11).
What are the key properties of 3-hydrazinylpiperidine-1-carboxylic acid?
3-hydrazinylpiperidine-1-carboxylic acid has a molecular weight of 159.19 g/mol, XLogP of -0.41, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydrazinylpiperidine-1-carboxylic acid is sourced from PubChem (CID 126736285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).