About cyclopentylhydrazine;2-(cyclopentylhydrazinylidene)propanoic acid
cyclopentylhydrazine;2-(cyclopentylhydrazinylidene)propanoic acid (PubChem CID 157428322) has the molecular formula C13H26N4O2
and a molecular weight of 270.38 g/mol. Its IUPAC name is cyclopentylhydrazine;2-(cyclopentylhydrazinylidene)propanoic acid.
Molecular Properties
| Compound Name | cyclopentylhydrazine;2-(cyclopentylhydrazinylidene)propanoic acid |
| PubChem CID | 157428322 |
| Molecular Formula | C13H26N4O2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | cyclopentylhydrazine;2-(cyclopentylhydrazinylidene)propanoic acid |
| SMILES | CC(=NNC1CCCC1)C(=O)O.NNC1CCCC1 |
| InChI | InChI=1S/C8H14N2O2.C5H12N2/c1-6(8(11)12)9-10-7-4-2-3-5-7;6-7-5-3-1-2-4-5/h7,10H,2-5H2,1H3,(H,11,12);5,7H,1-4,6H2 |
| InChIKey | BQFNSXFDTMITKF-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cyclopentylhydrazine;2-(cyclopentylhydrazinylidene)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentylhydrazine;2-(cyclopentylhydrazinylidene)propanoic acid?
The IUPAC name of cyclopentylhydrazine;2-(cyclopentylhydrazinylidene)propanoic acid (CID 157428322) is cyclopentylhydrazine;2-(cyclopentylhydrazinylidene)propanoic acid.
What is the SMILES notation for cyclopentylhydrazine;2-(cyclopentylhydrazinylidene)propanoic acid?
The canonical SMILES for cyclopentylhydrazine;2-(cyclopentylhydrazinylidene)propanoic acid is CC(=NNC1CCCC1)C(=O)O.NNC1CCCC1.
What is the InChIKey of cyclopentylhydrazine;2-(cyclopentylhydrazinylidene)propanoic acid?
The InChIKey is BQFNSXFDTMITKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2.C5H12N2/c1-6(8(11)12)9-10-7-4-2-3-5-7;6-7-5-3-1-2-4-5/h7,10H,2-5H2,1H3,(H,11,12);5,7H,1-4,6H2.
What are the key properties of cyclopentylhydrazine;2-(cyclopentylhydrazinylidene)propanoic acid?
cyclopentylhydrazine;2-(cyclopentylhydrazinylidene)propanoic acid has a molecular weight of 270.38 g/mol, XLogP of 1.37, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentylhydrazine;2-(cyclopentylhydrazinylidene)propanoic acid is sourced from PubChem (CID 157428322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).