C8H15N — CID 142007594
(3R,4R)-3-ethenyl-4-methylpiperidine (PubChem CID 142007594) has the molecular formula C8H15N and a molecular weight of 125.22 g/mol. Its IUPAC name is (3R,4R)-3-ethenyl-4-methylpiperidine.
| Compound Name | (3R,4R)-3-ethenyl-4-methylpiperidine |
|---|---|
| PubChem CID | 142007594 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.22 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | (3R,4R)-3-ethenyl-4-methylpiperidine |
| SMILES | C=C[C@H]1CNCC[C@H]1C |
| InChI | InChI=1S/C8H15N/c1-3-8-6-9-5-4-7(8)2/h3,7-9H,1,4-6H2,2H3/t7-,8+/m1/s1 |
| InChIKey | IRWCVRQNHZUOLL-SFYZADRCSA-N |
| XLogP | 1.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.22 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|