C7H15NO — CID 124538044
[(3R,4S)-4-methylpiperidin-3-yl]methanol (PubChem CID 124538044) has the molecular formula C7H15NO and a molecular weight of 129.20 g/mol. Its IUPAC name is [(3R,4S)-4-methylpiperidin-3-yl]methanol.
| Compound Name | [(3R,4S)-4-methylpiperidin-3-yl]methanol |
|---|---|
| PubChem CID | 124538044 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | [(3R,4S)-4-methylpiperidin-3-yl]methanol |
| SMILES | C[C@H]1CCNC[C@@H]1CO |
| InChI | InChI=1S/C7H15NO/c1-6-2-3-8-4-7(6)5-9/h6-9H,2-5H2,1H3/t6-,7+/m0/s1 |
| InChIKey | XKQYEHVFBWMPDC-NKWVEPMBSA-N |
| XLogP | 0.22 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |