C7H14N2O3 — CID 154997614
[(3S,4S)-3-(hydroxymethyl)piperidin-4-yl]carbamic acid (PubChem CID 154997614) has the molecular formula C7H14N2O3 and a molecular weight of 174.20 g/mol. Its IUPAC name is [(3S,4S)-3-(hydroxymethyl)piperidin-4-yl]carbamic acid.
| Compound Name | [(3S,4S)-3-(hydroxymethyl)piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 154997614 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | [(3S,4S)-3-(hydroxymethyl)piperidin-4-yl]carbamic acid |
| SMILES | O=C(O)N[C@H]1CCNC[C@@H]1CO |
| InChI | InChI=1S/C7H14N2O3/c10-4-5-3-8-2-1-6(5)9-7(11)12/h5-6,8-10H,1-4H2,(H,11,12)/t5-,6+/m1/s1 |
| InChIKey | KKJZENLQRYFKND-RITPCOANSA-N |
| XLogP | -0.78 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |