[(3R,4S)-4-(hydroxymethyl)oxolan-3-yl]carbamic acid

C6H11NO4 — CID 122437100

IUPAC[(3R,4S)-4-(hydroxymethyl)oxolan-3-yl]carbamic acid
SMILESO=C(O)N[C@H]1COC[C@@H]1CO
InChIInChI=1S/C6H11NO4/c8-1-4-2-11-3-5(4)7-6(9)10/h4-5,7-8H,1-3H2,(H,9,10)/t4-,5-/m0/s1
InChIKeyUAAFYALIWSBMQG-WHFBIAKZSA-N
MW161.16 g/mol
LogP-0.74
Rot. Bonds2

About [(3R,4S)-4-(hydroxymethyl)oxolan-3-yl]carbamic acid

[(3R,4S)-4-(hydroxymethyl)oxolan-3-yl]carbamic acid (PubChem CID 122437100) has the molecular formula C6H11NO4 and a molecular weight of 161.16 g/mol. Its IUPAC name is [(3R,4S)-4-(hydroxymethyl)oxolan-3-yl]carbamic acid.

Molecular Properties

Compound Name[(3R,4S)-4-(hydroxymethyl)oxolan-3-yl]carbamic acid
PubChem CID122437100
Molecular FormulaC6H11NO4
Molecular Weight161.16 g/mol
Exact Mass161.07
IUPAC Name[(3R,4S)-4-(hydroxymethyl)oxolan-3-yl]carbamic acid
SMILESO=C(O)N[C@H]1COC[C@@H]1CO
InChIInChI=1S/C6H11NO4/c8-1-4-2-11-3-5(4)7-6(9)10/h4-5,7-8H,1-3H2,(H,9,10)/t4-,5-/m0/s1
InChIKeyUAAFYALIWSBMQG-WHFBIAKZSA-N
XLogP-0.74
TPSA78.79 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500161.16
LogP ≤ 5-0.74
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze [(3R,4S)-4-(hydroxymethyl)oxolan-3-yl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(3R,4S)-4-(hydroxymethyl)oxolan-3-yl]carbamic acid?
The IUPAC name of [(3R,4S)-4-(hydroxymethyl)oxolan-3-yl]carbamic acid (CID 122437100) is [(3R,4S)-4-(hydroxymethyl)oxolan-3-yl]carbamic acid.
What is the SMILES notation for [(3R,4S)-4-(hydroxymethyl)oxolan-3-yl]carbamic acid?
The canonical SMILES for [(3R,4S)-4-(hydroxymethyl)oxolan-3-yl]carbamic acid is O=C(O)N[C@H]1COC[C@@H]1CO.
What is the InChIKey of [(3R,4S)-4-(hydroxymethyl)oxolan-3-yl]carbamic acid?
The InChIKey is UAAFYALIWSBMQG-WHFBIAKZSA-N. The full InChI is InChI=1S/C6H11NO4/c8-1-4-2-11-3-5(4)7-6(9)10/h4-5,7-8H,1-3H2,(H,9,10)/t4-,5-/m0/s1.
What are the key properties of [(3R,4S)-4-(hydroxymethyl)oxolan-3-yl]carbamic acid?
[(3R,4S)-4-(hydroxymethyl)oxolan-3-yl]carbamic acid has a molecular weight of 161.16 g/mol, XLogP of -0.74, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S)-4-(hydroxymethyl)oxolan-3-yl]carbamic acid is sourced from PubChem (CID 122437100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).