C6H11NO4 — CID 122437100
[(3R,4S)-4-(hydroxymethyl)oxolan-3-yl]carbamic acid (PubChem CID 122437100) has the molecular formula C6H11NO4 and a molecular weight of 161.16 g/mol. Its IUPAC name is [(3R,4S)-4-(hydroxymethyl)oxolan-3-yl]carbamic acid.
| Compound Name | [(3R,4S)-4-(hydroxymethyl)oxolan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 122437100 |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | [(3R,4S)-4-(hydroxymethyl)oxolan-3-yl]carbamic acid |
| SMILES | O=C(O)N[C@H]1COC[C@@H]1CO |
| InChI | InChI=1S/C6H11NO4/c8-1-4-2-11-3-5(4)7-6(9)10/h4-5,7-8H,1-3H2,(H,9,10)/t4-,5-/m0/s1 |
| InChIKey | UAAFYALIWSBMQG-WHFBIAKZSA-N |
| XLogP | -0.74 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |