C5H11NO2 — CID 131463106
[(3R,4S)-4-aminooxolan-3-yl]methanol (PubChem CID 131463106) has the molecular formula C5H11NO2 and a molecular weight of 117.15 g/mol. Its IUPAC name is [(3R,4S)-4-aminooxolan-3-yl]methanol.
| Compound Name | [(3R,4S)-4-aminooxolan-3-yl]methanol |
|---|---|
| PubChem CID | 131463106 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | [(3R,4S)-4-aminooxolan-3-yl]methanol |
| SMILES | N[C@@H]1COC[C@H]1CO |
| InChI | InChI=1S/C5H11NO2/c6-5-3-8-2-4(5)1-7/h4-5,7H,1-3,6H2/t4-,5-/m1/s1 |
| InChIKey | UEOVIIQBMQIOGG-RFZPGFLSSA-N |
| XLogP | -1.05 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |