About [(4R,5S)-4-(hydroxymethyl)-1,3-dioxan-5-yl]methanol
[(4R,5S)-4-(hydroxymethyl)-1,3-dioxan-5-yl]methanol (PubChem CID 131057194) has the molecular formula C6H12O4
and a molecular weight of 148.16 g/mol. Its IUPAC name is [(4R,5S)-4-(hydroxymethyl)-1,3-dioxan-5-yl]methanol.
Analyze [(4R,5S)-4-(hydroxymethyl)-1,3-dioxan-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R,5S)-4-(hydroxymethyl)-1,3-dioxan-5-yl]methanol?
The IUPAC name of [(4R,5S)-4-(hydroxymethyl)-1,3-dioxan-5-yl]methanol (CID 131057194) is [(4R,5S)-4-(hydroxymethyl)-1,3-dioxan-5-yl]methanol.
What is the SMILES notation for [(4R,5S)-4-(hydroxymethyl)-1,3-dioxan-5-yl]methanol?
The canonical SMILES for [(4R,5S)-4-(hydroxymethyl)-1,3-dioxan-5-yl]methanol is OC[C@H]1COCO[C@H]1CO.
What is the InChIKey of [(4R,5S)-4-(hydroxymethyl)-1,3-dioxan-5-yl]methanol?
The InChIKey is HKYOBQNCGXWHRL-WDSKDSINSA-N. The full InChI is InChI=1S/C6H12O4/c7-1-5-3-9-4-10-6(5)2-8/h5-8H,1-4H2/t5-,6-/m0/s1.
What are the key properties of [(4R,5S)-4-(hydroxymethyl)-1,3-dioxan-5-yl]methanol?
[(4R,5S)-4-(hydroxymethyl)-1,3-dioxan-5-yl]methanol has a molecular weight of 148.16 g/mol, XLogP of -1.04, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R,5S)-4-(hydroxymethyl)-1,3-dioxan-5-yl]methanol is sourced from PubChem (CID 131057194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).