C16H28O — CID 142195088
ethane;2-ethenyl-3-methyl-1,2,3,4,4a,8a-hexahydronaphthalene;methanol (PubChem CID 142195088) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is ethane;2-ethenyl-3-methyl-1,2,3,4,4a,8a-hexahydronaphthalene;methanol.
| Compound Name | ethane;2-ethenyl-3-methyl-1,2,3,4,4a,8a-hexahydronaphthalene;methanol |
|---|---|
| PubChem CID | 142195088 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | ethane;2-ethenyl-3-methyl-1,2,3,4,4a,8a-hexahydronaphthalene;methanol |
| SMILES | C=CC1CC2C=CC=CC2CC1C.CC.CO |
| InChI | InChI=1S/C13H18.C2H6.CH4O/c1-3-11-9-13-7-5-4-6-12(13)8-10(11)2;2*1-2/h3-7,10-13H,1,8-9H2,2H3;1-2H3;2H,1H3 |
| InChIKey | IKECXLPKHSHABH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|