C14H20 — CID 148825764
1-but-3-enyl-3-methyl-2,3,3a,7a-tetrahydro-1H-indene (PubChem CID 148825764) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is 1-but-3-enyl-3-methyl-2,3,3a,7a-tetrahydro-1H-indene.
| Compound Name | 1-but-3-enyl-3-methyl-2,3,3a,7a-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 148825764 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 1-but-3-enyl-3-methyl-2,3,3a,7a-tetrahydro-1H-indene |
| SMILES | C=CCCC1CC(C)C2C=CC=CC12 |
| InChI | InChI=1S/C14H20/c1-3-4-7-12-10-11(2)13-8-5-6-9-14(12)13/h3,5-6,8-9,11-14H,1,4,7,10H2,2H3 |
| InChIKey | OSRKPDHPNCHAMK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|