C25H45NOSi — CID 140875543
N-[dimethyl-[3-[6-[(2-methylpropan-2-yl)oxy]hexyl]-2,3,3a,7a-tetrahydro-1H-inden-1-yl]silyl]but-3-en-1-amine (PubChem CID 140875543) has the molecular formula C25H45NOSi and a molecular weight of 403.73 g/mol. Its IUPAC name is N-[dimethyl-[3-[6-[(2-methylpropan-2-yl)oxy]hexyl]-2,3,3a,7a-tetrahydro-1H-inden-1-yl]silyl]but-3-en-1-amine.
| Compound Name | N-[dimethyl-[3-[6-[(2-methylpropan-2-yl)oxy]hexyl]-2,3,3a,7a-tetrahydro-1H-inden-1-yl]silyl]but-3-en-1-amine |
|---|---|
| PubChem CID | 140875543 |
| Molecular Formula | C25H45NOSi |
| Molecular Weight | 403.73 g/mol |
| Exact Mass | 403.33 |
| IUPAC Name | N-[dimethyl-[3-[6-[(2-methylpropan-2-yl)oxy]hexyl]-2,3,3a,7a-tetrahydro-1H-inden-1-yl]silyl]but-3-en-1-amine |
| SMILES | C=CCCN[Si](C)(C)C1CC(CCCCCCOC(C)(C)C)C2C=CC=CC21 |
| InChI | InChI=1S/C25H45NOSi/c1-7-8-18-26-28(5,6)24-20-21(22-16-12-13-17-23(22)24)15-11-9-10-14-19-27-25(2,3)4/h7,12-13,16-17,21-24,26H,1,8-11,14-15,18-20H2,2-6H3 |
| InChIKey | XRVVNBGYHRVOPV-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.73 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|