C35H62N2Si2 — CID 23230013
N-[[2-[5-[1-[(tert-butylamino)-dimethylsilyl]-2,3,3a,7a-tetrahydro-1H-inden-2-yl]pentyl]-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilyl]-2-methylpropan-2-amine (PubChem CID 23230013) has the molecular formula C35H62N2Si2 and a molecular weight of 567.07 g/mol. Its IUPAC name is N-[[2-[5-[1-[(tert-butylamino)-dimethylsilyl]-2,3,3a,7a-tetrahydro-1H-inden-2-yl]pentyl]-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilyl]-2-methylpropan-2-amine.
| Compound Name | N-[[2-[5-[1-[(tert-butylamino)-dimethylsilyl]-2,3,3a,7a-tetrahydro-1H-inden-2-yl]pentyl]-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 23230013 |
| Molecular Formula | C35H62N2Si2 |
| Molecular Weight | 567.07 g/mol |
| Exact Mass | 566.45 |
| IUPAC Name | N-[[2-[5-[1-[(tert-butylamino)-dimethylsilyl]-2,3,3a,7a-tetrahydro-1H-inden-2-yl]pentyl]-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)N[Si](C)(C)C1C(CCCCCC2CC3C=CC=CC3C2[Si](C)(C)NC(C)(C)C)CC2C=CC=CC21 |
| InChI | InChI=1S/C35H62N2Si2/c1-34(2,3)36-38(7,8)32-28(24-26-18-14-16-22-30(26)32)20-12-11-13-21-29-25-27-19-15-17-23-31(27)33(29)39(9,10)37-35(4,5)6/h14-19,22-23,26-33,36-37H,11-13,20-21,24-25H2,1-10H3 |
| InChIKey | QPNZCUSWQBLJPF-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.07 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|