C20H34O — CID 146199533
1-methyl-3-[6-[(2-methylpropan-2-yl)oxy]hexyl]-2,3,3a,7a-tetrahydro-1H-indene (PubChem CID 146199533) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is 1-methyl-3-[6-[(2-methylpropan-2-yl)oxy]hexyl]-2,3,3a,7a-tetrahydro-1H-indene.
| Compound Name | 1-methyl-3-[6-[(2-methylpropan-2-yl)oxy]hexyl]-2,3,3a,7a-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 146199533 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | 1-methyl-3-[6-[(2-methylpropan-2-yl)oxy]hexyl]-2,3,3a,7a-tetrahydro-1H-indene |
| SMILES | CC1CC(CCCCCCOC(C)(C)C)C2C=CC=CC12 |
| InChI | InChI=1S/C20H34O/c1-16-15-17(19-13-9-8-12-18(16)19)11-7-5-6-10-14-21-20(2,3)4/h8-9,12-13,16-19H,5-7,10-11,14-15H2,1-4H3 |
| InChIKey | VHYLZJNZYVTVEB-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|