C27H47NOSi — CID 153497921
N-[dimethyl-[3-[6-[(2-methylpropan-2-yl)oxy]hexyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]silyl]aniline (PubChem CID 153497921) has the molecular formula C27H47NOSi and a molecular weight of 429.77 g/mol. Its IUPAC name is N-[dimethyl-[3-[6-[(2-methylpropan-2-yl)oxy]hexyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]silyl]aniline.
| Compound Name | N-[dimethyl-[3-[6-[(2-methylpropan-2-yl)oxy]hexyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]silyl]aniline |
|---|---|
| PubChem CID | 153497921 |
| Molecular Formula | C27H47NOSi |
| Molecular Weight | 429.77 g/mol |
| Exact Mass | 429.34 |
| IUPAC Name | N-[dimethyl-[3-[6-[(2-methylpropan-2-yl)oxy]hexyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]silyl]aniline |
| SMILES | CC(C)(C)OCCCCCCC1CC([Si](C)(C)Nc2ccccc2)C2CCCCC12 |
| InChI | InChI=1S/C27H47NOSi/c1-27(2,3)29-20-14-7-6-9-15-22-21-26(25-19-13-12-18-24(22)25)30(4,5)28-23-16-10-8-11-17-23/h8,10-11,16-17,22,24-26,28H,6-7,9,12-15,18-21H2,1-5H3 |
| InChIKey | LSJHYZLDPAZTHH-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.77 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|