C56H84Si — CID 123692672
(3-hex-5-enyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-(5,5,8,8,16,16,19,19-octamethyl-12-pentacyclo[11.8.0.02,11.04,9.015,20]henicosanyl)-diphenylsilane (PubChem CID 123692672) has the molecular formula C56H84Si and a molecular weight of 785.37 g/mol. Its IUPAC name is (3-hex-5-enyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-(5,5,8,8,16,16,19,19-octamethyl-12-pentacyclo[11.8.0.02,11.04,9.015,20]henicosanyl)-diphenylsilane.
| Compound Name | (3-hex-5-enyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-(5,5,8,8,16,16,19,19-octamethyl-12-pentacyclo[11.8.0.02,11.04,9.015,20]henicosanyl)-diphenylsilane |
|---|---|
| PubChem CID | 123692672 |
| Molecular Formula | C56H84Si |
| Molecular Weight | 785.37 g/mol |
| Exact Mass | 784.63 |
| IUPAC Name | (3-hex-5-enyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-(5,5,8,8,16,16,19,19-octamethyl-12-pentacyclo[11.8.0.02,11.04,9.015,20]henicosanyl)-diphenylsilane |
| SMILES | C=CCCCCC1CC([Si](c2ccccc2)(c2ccccc2)C2C3CC4C(CC3C3CC5C(CC32)C(C)(C)CCC5(C)C)C(C)(C)CCC4(C)C)C2CCCCC12 |
| InChI | InChI=1S/C56H84Si/c1-10-11-12-15-22-38-33-51(42-28-21-20-27-41(38)42)57(39-23-16-13-17-24-39,40-25-18-14-19-26-40)52-45-36-49-47(53(2,3)29-31-55(49,6)7)34-43(45)44-35-48-50(37-46(44)52)56(8,9)32-30-54(48,4)5/h10,13-14,16-19,23-26,38,41-52H,1,11-12,15,20-22,27-37H2,2-9H3 |
| InChIKey | GSQAKYZVFIIVGI-UHFFFAOYSA-N |
| XLogP | 14.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.37 |
| LogP ≤ 5 | 14.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|