C29H34Si — CID 58049466
cyclopentyl-diphenyl-(3-prop-2-enyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)silane (PubChem CID 58049466) has the molecular formula C29H34Si and a molecular weight of 410.68 g/mol. Its IUPAC name is cyclopentyl-diphenyl-(3-prop-2-enyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)silane.
| Compound Name | cyclopentyl-diphenyl-(3-prop-2-enyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)silane |
|---|---|
| PubChem CID | 58049466 |
| Molecular Formula | C29H34Si |
| Molecular Weight | 410.68 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | cyclopentyl-diphenyl-(3-prop-2-enyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)silane |
| SMILES | C=CCC1CC([Si](c2ccccc2)(c2ccccc2)C2CCCC2)C2C=CC=CC12 |
| InChI | InChI=1S/C29H34Si/c1-2-13-23-22-29(28-21-12-11-20-27(23)28)30(26-18-9-10-19-26,24-14-5-3-6-15-24)25-16-7-4-8-17-25/h2-8,11-12,14-17,20-21,23,26-29H,1,9-10,13,18-19,22H2 |
| InChIKey | HMEFIAKKNZVACZ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.68 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|