C22H32 — CID 91170304
1-(3-cyclopent-2-en-1-ylpentan-3-yl)-3-prop-2-enyl-2,3,3a,7a-tetrahydro-1H-indene (PubChem CID 91170304) has the molecular formula C22H32 and a molecular weight of 296.50 g/mol. Its IUPAC name is 1-(3-cyclopent-2-en-1-ylpentan-3-yl)-3-prop-2-enyl-2,3,3a,7a-tetrahydro-1H-indene.
| Compound Name | 1-(3-cyclopent-2-en-1-ylpentan-3-yl)-3-prop-2-enyl-2,3,3a,7a-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 91170304 |
| Molecular Formula | C22H32 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 1-(3-cyclopent-2-en-1-ylpentan-3-yl)-3-prop-2-enyl-2,3,3a,7a-tetrahydro-1H-indene |
| SMILES | C=CCC1CC(C(CC)(CC)C2C=CCC2)C2C=CC=CC12 |
| InChI | InChI=1S/C22H32/c1-4-11-17-16-21(20-15-10-9-14-19(17)20)22(5-2,6-3)18-12-7-8-13-18/h4,7,9-10,12,14-15,17-21H,1,5-6,8,11,13,16H2,2-3H3 |
| InChIKey | TWJGWTWPOJBRIS-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|