C15H22O4 — CID 132553067
dimethyl 2-cyclopent-2-en-1-yl-2-pent-4-enylpropanedioate (PubChem CID 132553067) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is dimethyl 2-cyclopent-2-en-1-yl-2-pent-4-enylpropanedioate.
| Compound Name | dimethyl 2-cyclopent-2-en-1-yl-2-pent-4-enylpropanedioate |
|---|---|
| PubChem CID | 132553067 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | dimethyl 2-cyclopent-2-en-1-yl-2-pent-4-enylpropanedioate |
| SMILES | C=CCCCC(C(=O)OC)(C(=O)OC)C1C=CCC1 |
| InChI | InChI=1S/C15H22O4/c1-4-5-8-11-15(13(16)18-2,14(17)19-3)12-9-6-7-10-12/h4,6,9,12H,1,5,7-8,10-11H2,2-3H3 |
| InChIKey | AAGXNZWNCBFKST-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|