C20H30O4 — CID 101305804
bis(hex-5-enyl) cyclohex-3-ene-1,2-dicarboxylate (PubChem CID 101305804) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is bis(hex-5-enyl) cyclohex-3-ene-1,2-dicarboxylate.
| Compound Name | bis(hex-5-enyl) cyclohex-3-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 101305804 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | bis(hex-5-enyl) cyclohex-3-ene-1,2-dicarboxylate |
| SMILES | C=CCCCCOC(=O)C1C=CCCC1C(=O)OCCCCC=C |
| InChI | InChI=1S/C20H30O4/c1-3-5-7-11-15-23-19(21)17-13-9-10-14-18(17)20(22)24-16-12-8-6-4-2/h3-4,9,13,17-18H,1-2,5-8,10-12,14-16H2 |
| InChIKey | AHTNPEQPVVAZAU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|