C16H14F12O4 — CID 139640338
bis[3,3,3-trifluoro-2-(trifluoromethyl)propyl] cyclohex-3-ene-1,2-dicarboxylate (PubChem CID 139640338) has the molecular formula C16H14F12O4 and a molecular weight of 498.26 g/mol. Its IUPAC name is bis[3,3,3-trifluoro-2-(trifluoromethyl)propyl] cyclohex-3-ene-1,2-dicarboxylate.
| Compound Name | bis[3,3,3-trifluoro-2-(trifluoromethyl)propyl] cyclohex-3-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139640338 |
| Molecular Formula | C16H14F12O4 |
| Molecular Weight | 498.26 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | bis[3,3,3-trifluoro-2-(trifluoromethyl)propyl] cyclohex-3-ene-1,2-dicarboxylate |
| SMILES | O=C(OCC(C(F)(F)F)C(F)(F)F)C1C=CCCC1C(=O)OCC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H14F12O4/c17-13(18,19)9(14(20,21)22)5-31-11(29)7-3-1-2-4-8(7)12(30)32-6-10(15(23,24)25)16(26,27)28/h1,3,7-10H,2,4-6H2 |
| InChIKey | YYIMGSKHBHFVFJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.26 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|