C13H16O5 — CID 158772879
1-O-ethyl 2-O-prop-2-enoyl cyclohex-3-ene-1,2-dicarboxylate (PubChem CID 158772879) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is 1-O-ethyl 2-O-prop-2-enoyl cyclohex-3-ene-1,2-dicarboxylate.
| Compound Name | 1-O-ethyl 2-O-prop-2-enoyl cyclohex-3-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 158772879 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 1-O-ethyl 2-O-prop-2-enoyl cyclohex-3-ene-1,2-dicarboxylate |
| SMILES | C=CC(=O)OC(=O)C1C=CCCC1C(=O)OCC |
| InChI | InChI=1S/C13H16O5/c1-3-11(14)18-13(16)10-8-6-5-7-9(10)12(15)17-4-2/h3,6,8-10H,1,4-5,7H2,2H3 |
| InChIKey | IQCDHQHNZHRETR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|