C22H32O4 — CID 159795749
cyclohexa-1,3-diene;ethyl bicyclo[2.2.2]oct-5-ene-2-carboxylate;ethyl prop-2-enoate (PubChem CID 159795749) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is cyclohexa-1,3-diene;ethyl bicyclo[2.2.2]oct-5-ene-2-carboxylate;ethyl prop-2-enoate.
| Compound Name | cyclohexa-1,3-diene;ethyl bicyclo[2.2.2]oct-5-ene-2-carboxylate;ethyl prop-2-enoate |
|---|---|
| PubChem CID | 159795749 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | cyclohexa-1,3-diene;ethyl bicyclo[2.2.2]oct-5-ene-2-carboxylate;ethyl prop-2-enoate |
| SMILES | C1=CCCC=C1.C=CC(=O)OCC.CCOC(=O)C1CC2C=CC1CC2 |
| InChI | InChI=1S/C11H16O2.C6H8.C5H8O2/c1-2-13-11(12)10-7-8-3-5-9(10)6-4-8;1-2-4-6-5-3-1;1-3-5(6)7-4-2/h3,5,8-10H,2,4,6-7H2,1H3;1-4H,5-6H2;3H,1,4H2,2H3 |
| InChIKey | NJDQDUMOGSETAU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|