C10H14O4 — CID 134992131
dimethyl (1R,2S)-cyclohex-3-ene-1,2-dicarboxylate (PubChem CID 134992131) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is dimethyl (1R,2S)-cyclohex-3-ene-1,2-dicarboxylate.
| Compound Name | dimethyl (1R,2S)-cyclohex-3-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134992131 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | dimethyl (1R,2S)-cyclohex-3-ene-1,2-dicarboxylate |
| SMILES | COC(=O)[C@H]1C=CCC[C@H]1C(=O)OC |
| InChI | InChI=1S/C10H14O4/c1-13-9(11)7-5-3-4-6-8(7)10(12)14-2/h3,5,7-8H,4,6H2,1-2H3/t7-,8+/m0/s1 |
| InChIKey | IBZFNIMEOXVZMC-JGVFFNPUSA-N |
| XLogP | 0.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|