C12H18O5 — CID 160859102
6-butoxycarbonylcyclohex-2-ene-1-carboperoxoic acid (PubChem CID 160859102) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is 6-butoxycarbonylcyclohex-2-ene-1-carboperoxoic acid.
| Compound Name | 6-butoxycarbonylcyclohex-2-ene-1-carboperoxoic acid |
|---|---|
| PubChem CID | 160859102 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 6-butoxycarbonylcyclohex-2-ene-1-carboperoxoic acid |
| SMILES | CCCCOC(=O)C1CCC=CC1C(=O)OO |
| InChI | InChI=1S/C12H18O5/c1-2-3-8-16-11(13)9-6-4-5-7-10(9)12(14)17-15/h5,7,9-10,15H,2-4,6,8H2,1H3 |
| InChIKey | KQPAIGMSESGEFP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|