C32H52O8 — CID 158794518
bis(2-ethylhexyl) cyclohex-3-ene-1,2-dicarboxylate;cyclohex-3-ene-1,2-dicarboxylic acid (PubChem CID 158794518) has the molecular formula C32H52O8 and a molecular weight of 564.76 g/mol. Its IUPAC name is bis(2-ethylhexyl) cyclohex-3-ene-1,2-dicarboxylate;cyclohex-3-ene-1,2-dicarboxylic acid.
| Compound Name | bis(2-ethylhexyl) cyclohex-3-ene-1,2-dicarboxylate;cyclohex-3-ene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 158794518 |
| Molecular Formula | C32H52O8 |
| Molecular Weight | 564.76 g/mol |
| Exact Mass | 564.37 |
| IUPAC Name | bis(2-ethylhexyl) cyclohex-3-ene-1,2-dicarboxylate;cyclohex-3-ene-1,2-dicarboxylic acid |
| SMILES | CCCCC(CC)COC(=O)C1C=CCCC1C(=O)OCC(CC)CCCC.O=C(O)C1C=CCCC1C(=O)O |
| InChI | InChI=1S/C24H42O4.C8H10O4/c1-5-9-13-19(7-3)17-27-23(25)21-15-11-12-16-22(21)24(26)28-18-20(8-4)14-10-6-2;9-7(10)5-3-1-2-4-6(5)8(11)12/h11,15,19-22H,5-10,12-14,16-18H2,1-4H3;1,3,5-6H,2,4H2,(H,9,10)(H,11,12) |
| InChIKey | ISRULZCAACSEHK-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.76 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|