C41H78O4 — CID 139913117
bis(2-hexyldecyl) 4-methylcyclohexane-1,2-dicarboxylate (PubChem CID 139913117) has the molecular formula C41H78O4 and a molecular weight of 635.07 g/mol. Its IUPAC name is bis(2-hexyldecyl) 4-methylcyclohexane-1,2-dicarboxylate.
| Compound Name | bis(2-hexyldecyl) 4-methylcyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139913117 |
| Molecular Formula | C41H78O4 |
| Molecular Weight | 635.07 g/mol |
| Exact Mass | 634.59 |
| IUPAC Name | bis(2-hexyldecyl) 4-methylcyclohexane-1,2-dicarboxylate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)C1CCC(C)CC1C(=O)OCC(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C41H78O4/c1-6-10-14-18-20-24-28-36(26-22-16-12-8-3)33-44-40(42)38-31-30-35(5)32-39(38)41(43)45-34-37(27-23-17-13-9-4)29-25-21-19-15-11-7-2/h35-39H,6-34H2,1-5H3 |
| InChIKey | UIBCNPUQPCNGAN-UHFFFAOYSA-N |
| XLogP | 12.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.07 |
| LogP ≤ 5 | 12.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|