About CID 158982455
CID 158982455 (PubChem CID 158982455) has the molecular formula C8H10BiO4
and a molecular weight of 379.14 g/mol.
Molecular Properties
| Compound Name | CID 158982455 |
| PubChem CID | 158982455 |
| Molecular Formula | C8H10BiO4 |
| Molecular Weight | 379.14 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | — |
| SMILES | O=C(O)C1C=CCCC1C(=O)O.[Bi] |
| InChI | InChI=1S/C8H10O4.Bi/c9-7(10)5-3-1-2-4-6(5)8(11)12;/h1,3,5-6H,2,4H2,(H,9,10)(H,11,12); |
| InChIKey | JPEFNQBTPQCKCH-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.14 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 158982455 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158982455?
The IUPAC name of CID 158982455 (CID 158982455) is not available.
What is the SMILES notation for CID 158982455?
The canonical SMILES for CID 158982455 is O=C(O)C1C=CCCC1C(=O)O.[Bi].
What is the InChIKey of CID 158982455?
The InChIKey is JPEFNQBTPQCKCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4.Bi/c9-7(10)5-3-1-2-4-6(5)8(11)12;/h1,3,5-6H,2,4H2,(H,9,10)(H,11,12);.
What are the key properties of CID 158982455?
CID 158982455 has a molecular weight of 379.14 g/mol, XLogP of 0.36, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158982455 is sourced from PubChem (CID 158982455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).