C9H14O4 — CID 174553928
cyclohex-3-ene-1,2-dicarboxylic acid;methane (PubChem CID 174553928) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is cyclohex-3-ene-1,2-dicarboxylic acid;methane.
| Compound Name | cyclohex-3-ene-1,2-dicarboxylic acid;methane |
|---|---|
| PubChem CID | 174553928 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | cyclohex-3-ene-1,2-dicarboxylic acid;methane |
| SMILES | C.O=C(O)C1C=CCCC1C(=O)O |
| InChI | InChI=1S/C8H10O4.CH4/c9-7(10)5-3-1-2-4-6(5)8(11)12;/h1,3,5-6H,2,4H2,(H,9,10)(H,11,12);1H4 |
| InChIKey | ODPRWCXNFJVDLB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|