benzoyl chloride;cyclohex-3-ene-1,2-dicarboxylic acid

C15H15ClO5 — CID 174588900

IUPACbenzoyl chloride;cyclohex-3-ene-1,2-dicarboxylic acid
SMILESO=C(Cl)c1ccccc1.O=C(O)C1C=CCCC1C(=O)O
InChIInChI=1S/C8H10O4.C7H5ClO/c9-7(10)5-3-1-2-4-6(5)8(11)12;8-7(9)6-4-2-1-3-5-6/h1,3,5-6H,2,4H2,(H,9,10)(H,11,12);1-5H
InChIKeyQAJKDVWQSFUDSH-UHFFFAOYSA-N
MW310.73 g/mol
LogP2.80
Rot. Bonds3

About benzoyl chloride;cyclohex-3-ene-1,2-dicarboxylic acid

benzoyl chloride;cyclohex-3-ene-1,2-dicarboxylic acid (PubChem CID 174588900) has the molecular formula C15H15ClO5 and a molecular weight of 310.73 g/mol. Its IUPAC name is benzoyl chloride;cyclohex-3-ene-1,2-dicarboxylic acid.

Molecular Properties

Compound Namebenzoyl chloride;cyclohex-3-ene-1,2-dicarboxylic acid
PubChem CID174588900
Molecular FormulaC15H15ClO5
Molecular Weight310.73 g/mol
Exact Mass310.06
IUPAC Namebenzoyl chloride;cyclohex-3-ene-1,2-dicarboxylic acid
SMILESO=C(Cl)c1ccccc1.O=C(O)C1C=CCCC1C(=O)O
InChIInChI=1S/C8H10O4.C7H5ClO/c9-7(10)5-3-1-2-4-6(5)8(11)12;8-7(9)6-4-2-1-3-5-6/h1,3,5-6H,2,4H2,(H,9,10)(H,11,12);1-5H
InChIKeyQAJKDVWQSFUDSH-UHFFFAOYSA-N
XLogP2.80
TPSA91.67 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500310.73
LogP ≤ 52.80
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze benzoyl chloride;cyclohex-3-ene-1,2-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzoyl chloride;cyclohex-3-ene-1,2-dicarboxylic acid?
The IUPAC name of benzoyl chloride;cyclohex-3-ene-1,2-dicarboxylic acid (CID 174588900) is benzoyl chloride;cyclohex-3-ene-1,2-dicarboxylic acid.
What is the SMILES notation for benzoyl chloride;cyclohex-3-ene-1,2-dicarboxylic acid?
The canonical SMILES for benzoyl chloride;cyclohex-3-ene-1,2-dicarboxylic acid is O=C(Cl)c1ccccc1.O=C(O)C1C=CCCC1C(=O)O.
What is the InChIKey of benzoyl chloride;cyclohex-3-ene-1,2-dicarboxylic acid?
The InChIKey is QAJKDVWQSFUDSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4.C7H5ClO/c9-7(10)5-3-1-2-4-6(5)8(11)12;8-7(9)6-4-2-1-3-5-6/h1,3,5-6H,2,4H2,(H,9,10)(H,11,12);1-5H.
What are the key properties of benzoyl chloride;cyclohex-3-ene-1,2-dicarboxylic acid?
benzoyl chloride;cyclohex-3-ene-1,2-dicarboxylic acid has a molecular weight of 310.73 g/mol, XLogP of 2.80, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzoyl chloride;cyclohex-3-ene-1,2-dicarboxylic acid is sourced from PubChem (CID 174588900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).