2-methylcyclohex-3-ene-1-carbonyl chloride

C8H11ClO — CID 45081350

IUPAC2-methylcyclohex-3-ene-1-carbonyl chloride
SMILESCC1C=CCCC1C(=O)Cl
InChIInChI=1S/C8H11ClO/c1-6-4-2-3-5-7(6)8(9)10/h2,4,6-7H,3,5H2,1H3
InChIKeyPEWQXAKDEXZZGL-UHFFFAOYSA-N
MW158.63 g/mol
LogP2.35
Rot. Bonds1

About 2-methylcyclohex-3-ene-1-carbonyl chloride

2-methylcyclohex-3-ene-1-carbonyl chloride (PubChem CID 45081350) has the molecular formula C8H11ClO and a molecular weight of 158.63 g/mol. Its IUPAC name is 2-methylcyclohex-3-ene-1-carbonyl chloride.

Molecular Properties

Compound Name2-methylcyclohex-3-ene-1-carbonyl chloride
PubChem CID45081350
Molecular FormulaC8H11ClO
Molecular Weight158.63 g/mol
Exact Mass158.05
IUPAC Name2-methylcyclohex-3-ene-1-carbonyl chloride
SMILESCC1C=CCCC1C(=O)Cl
InChIInChI=1S/C8H11ClO/c1-6-4-2-3-5-7(6)8(9)10/h2,4,6-7H,3,5H2,1H3
InChIKeyPEWQXAKDEXZZGL-UHFFFAOYSA-N
XLogP2.35
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.63
LogP ≤ 52.35
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-methylcyclohex-3-ene-1-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methylcyclohex-3-ene-1-carbonyl chloride?
The IUPAC name of 2-methylcyclohex-3-ene-1-carbonyl chloride (CID 45081350) is 2-methylcyclohex-3-ene-1-carbonyl chloride.
What is the SMILES notation for 2-methylcyclohex-3-ene-1-carbonyl chloride?
The canonical SMILES for 2-methylcyclohex-3-ene-1-carbonyl chloride is CC1C=CCCC1C(=O)Cl.
What is the InChIKey of 2-methylcyclohex-3-ene-1-carbonyl chloride?
The InChIKey is PEWQXAKDEXZZGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClO/c1-6-4-2-3-5-7(6)8(9)10/h2,4,6-7H,3,5H2,1H3.
What are the key properties of 2-methylcyclohex-3-ene-1-carbonyl chloride?
2-methylcyclohex-3-ene-1-carbonyl chloride has a molecular weight of 158.63 g/mol, XLogP of 2.35, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylcyclohex-3-ene-1-carbonyl chloride is sourced from PubChem (CID 45081350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).