C24H32F6O4 — CID 139640413
bis[3-(trifluoromethyl)cycloheptyl] cyclohex-3-ene-1,2-dicarboxylate (PubChem CID 139640413) has the molecular formula C24H32F6O4 and a molecular weight of 498.50 g/mol. Its IUPAC name is bis[3-(trifluoromethyl)cycloheptyl] cyclohex-3-ene-1,2-dicarboxylate.
| Compound Name | bis[3-(trifluoromethyl)cycloheptyl] cyclohex-3-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139640413 |
| Molecular Formula | C24H32F6O4 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | bis[3-(trifluoromethyl)cycloheptyl] cyclohex-3-ene-1,2-dicarboxylate |
| SMILES | O=C(OC1CCCCC(C(F)(F)F)C1)C1C=CCCC1C(=O)OC1CCCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C24H32F6O4/c25-23(26,27)15-7-1-3-9-17(13-15)33-21(31)19-11-5-6-12-20(19)22(32)34-18-10-4-2-8-16(14-18)24(28,29)30/h5,11,15-20H,1-4,6-10,12-14H2 |
| InChIKey | JXWFUHJSXUAOHV-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|