About bis[3-(trifluoromethyl)cycloheptyl] cyclohex-3-ene-1,2-dicarboxylate
bis[3-(trifluoromethyl)cycloheptyl] cyclohex-3-ene-1,2-dicarboxylate (PubChem CID 139640413) has the molecular formula C24H32F6O4
and a molecular weight of 498.50 g/mol. Its IUPAC name is bis[3-(trifluoromethyl)cycloheptyl] cyclohex-3-ene-1,2-dicarboxylate.
Molecular Properties
| Compound Name | bis[3-(trifluoromethyl)cycloheptyl] cyclohex-3-ene-1,2-dicarboxylate |
| PubChem CID | 139640413 |
| Molecular Formula | C24H32F6O4 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | bis[3-(trifluoromethyl)cycloheptyl] cyclohex-3-ene-1,2-dicarboxylate |
| SMILES | O=C(OC1CCCCC(C(F)(F)F)C1)C1C=CCCC1C(=O)OC1CCCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C24H32F6O4/c25-23(26,27)15-7-1-3-9-17(13-15)33-21(31)19-11-5-6-12-20(19)22(32)34-18-10-4-2-8-16(14-18)24(28,29)30/h5,11,15-20H,1-4,6-10,12-14H2 |
| InChIKey | JXWFUHJSXUAOHV-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis[3-(trifluoromethyl)cycloheptyl] cyclohex-3-ene-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[3-(trifluoromethyl)cycloheptyl] cyclohex-3-ene-1,2-dicarboxylate?
The IUPAC name of bis[3-(trifluoromethyl)cycloheptyl] cyclohex-3-ene-1,2-dicarboxylate (CID 139640413) is bis[3-(trifluoromethyl)cycloheptyl] cyclohex-3-ene-1,2-dicarboxylate.
What is the SMILES notation for bis[3-(trifluoromethyl)cycloheptyl] cyclohex-3-ene-1,2-dicarboxylate?
The canonical SMILES for bis[3-(trifluoromethyl)cycloheptyl] cyclohex-3-ene-1,2-dicarboxylate is O=C(OC1CCCCC(C(F)(F)F)C1)C1C=CCCC1C(=O)OC1CCCCC(C(F)(F)F)C1.
What is the InChIKey of bis[3-(trifluoromethyl)cycloheptyl] cyclohex-3-ene-1,2-dicarboxylate?
The InChIKey is JXWFUHJSXUAOHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H32F6O4/c25-23(26,27)15-7-1-3-9-17(13-15)33-21(31)19-11-5-6-12-20(19)22(32)34-18-10-4-2-8-16(14-18)24(28,29)30/h5,11,15-20H,1-4,6-10,12-14H2.
What are the key properties of bis[3-(trifluoromethyl)cycloheptyl] cyclohex-3-ene-1,2-dicarboxylate?
bis[3-(trifluoromethyl)cycloheptyl] cyclohex-3-ene-1,2-dicarboxylate has a molecular weight of 498.50 g/mol, XLogP of 6.68, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis[3-(trifluoromethyl)cycloheptyl] cyclohex-3-ene-1,2-dicarboxylate is sourced from PubChem (CID 139640413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).