C21H32OSi — CID 10892816
(1S)-1-[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]-1-[dimethyl(phenyl)silyl]but-3-en-1-ol (PubChem CID 10892816) has the molecular formula C21H32OSi and a molecular weight of 328.57 g/mol. Its IUPAC name is (1S)-1-[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]-1-[dimethyl(phenyl)silyl]but-3-en-1-ol.
| Compound Name | (1S)-1-[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]-1-[dimethyl(phenyl)silyl]but-3-en-1-ol |
|---|---|
| PubChem CID | 10892816 |
| Molecular Formula | C21H32OSi |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (1S)-1-[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]-1-[dimethyl(phenyl)silyl]but-3-en-1-ol |
| SMILES | C=CC[C@@](O)([C@H]1CC[C@H]2C[C@@H]1C2(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C21H32OSi/c1-6-14-21(22,23(4,5)17-10-8-7-9-11-17)18-13-12-16-15-19(18)20(16,2)3/h6-11,16,18-19,22H,1,12-15H2,2-5H3/t16-,18-,19-,21-/m0/s1 |
| InChIKey | PHTZYKQBJFQUMJ-WBKMXMRLSA-N |
| XLogP | 4.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|