C20H27NSi — CID 101362394
1-[dimethyl(phenyl)silyl]-N,N-dimethyl-1-phenylbut-3-en-1-amine (PubChem CID 101362394) has the molecular formula C20H27NSi and a molecular weight of 309.53 g/mol. Its IUPAC name is 1-[dimethyl(phenyl)silyl]-N,N-dimethyl-1-phenylbut-3-en-1-amine.
| Compound Name | 1-[dimethyl(phenyl)silyl]-N,N-dimethyl-1-phenylbut-3-en-1-amine |
|---|---|
| PubChem CID | 101362394 |
| Molecular Formula | C20H27NSi |
| Molecular Weight | 309.53 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 1-[dimethyl(phenyl)silyl]-N,N-dimethyl-1-phenylbut-3-en-1-amine |
| SMILES | C=CCC(c1ccccc1)(N(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C20H27NSi/c1-6-17-20(21(2)3,18-13-9-7-10-14-18)22(4,5)19-15-11-8-12-16-19/h6-16H,1,17H2,2-5H3 |
| InChIKey | XLCLZAIOTKSVBN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|