C24H34OSi2 — CID 101213388
[1-cyclobutyl-1-[dimethyl(phenyl)silyl]but-3-enoxy]-dimethyl-phenylsilane (PubChem CID 101213388) has the molecular formula C24H34OSi2 and a molecular weight of 394.71 g/mol. Its IUPAC name is [1-cyclobutyl-1-[dimethyl(phenyl)silyl]but-3-enoxy]-dimethyl-phenylsilane.
| Compound Name | [1-cyclobutyl-1-[dimethyl(phenyl)silyl]but-3-enoxy]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 101213388 |
| Molecular Formula | C24H34OSi2 |
| Molecular Weight | 394.71 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | [1-cyclobutyl-1-[dimethyl(phenyl)silyl]but-3-enoxy]-dimethyl-phenylsilane |
| SMILES | C=CCC(O[Si](C)(C)c1ccccc1)(C1CCC1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C24H34OSi2/c1-6-20-24(21-14-13-15-21,26(2,3)22-16-9-7-10-17-22)25-27(4,5)23-18-11-8-12-19-23/h6-12,16-19,21H,1,13-15,20H2,2-5H3 |
| InChIKey | LJRWSZVAMMGGSO-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.71 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|