C19H26 — CID 100973093
(1R,2S,5R)-6,6-dimethyl-2-[(2S)-2-phenylbut-3-enyl]bicyclo[3.1.1]heptane (PubChem CID 100973093) has the molecular formula C19H26 and a molecular weight of 254.42 g/mol. Its IUPAC name is (1R,2S,5R)-6,6-dimethyl-2-[(2S)-2-phenylbut-3-enyl]bicyclo[3.1.1]heptane.
| Compound Name | (1R,2S,5R)-6,6-dimethyl-2-[(2S)-2-phenylbut-3-enyl]bicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 100973093 |
| Molecular Formula | C19H26 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | (1R,2S,5R)-6,6-dimethyl-2-[(2S)-2-phenylbut-3-enyl]bicyclo[3.1.1]heptane |
| SMILES | C=C[C@H](C[C@@H]1CC[C@@H]2C[C@H]1C2(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H26/c1-4-14(15-8-6-5-7-9-15)12-16-10-11-17-13-18(16)19(17,2)3/h4-9,14,16-18H,1,10-13H2,2-3H3/t14-,16+,17-,18-/m1/s1 |
| InChIKey | LQUOQJGFBBLAHK-BZZMCLGOSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|