C19H26N+ — CID 10651011
2-[[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]-3,4-dihydroisoquinolin-2-ium (PubChem CID 10651011) has the molecular formula C19H26N+ and a molecular weight of 268.42 g/mol. Its IUPAC name is 2-[[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]-3,4-dihydroisoquinolin-2-ium.
| Compound Name | 2-[[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]-3,4-dihydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 10651011 |
| Molecular Formula | C19H26N+ |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.21 |
| IUPAC Name | 2-[[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]-3,4-dihydroisoquinolin-2-ium |
| SMILES | CC1(C)[C@H]2CC[C@H](C[N+]3=Cc4ccccc4CC3)[C@@H]1C2 |
| InChI | InChI=1S/C19H26N/c1-19(2)17-8-7-16(18(19)11-17)13-20-10-9-14-5-3-4-6-15(14)12-20/h3-6,12,16-18H,7-11,13H2,1-2H3/q+1/t16-,17+,18+/m1/s1 |
| InChIKey | MWCNYZZBHDRBQN-SQNIBIBYSA-N |
| XLogP | 3.75 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|