C43H46BN — CID 10651010
2-[[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]-3,4-dihydroisoquinolin-2-ium;tetraphenylboranuide (PubChem CID 10651010) has the molecular formula C43H46BN and a molecular weight of 587.66 g/mol. Its IUPAC name is 2-[[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]-3,4-dihydroisoquinolin-2-ium;tetraphenylboranuide.
| Compound Name | 2-[[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]-3,4-dihydroisoquinolin-2-ium;tetraphenylboranuide |
|---|---|
| PubChem CID | 10651010 |
| Molecular Formula | C43H46BN |
| Molecular Weight | 587.66 g/mol |
| Exact Mass | 587.37 |
| IUPAC Name | 2-[[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]-3,4-dihydroisoquinolin-2-ium;tetraphenylboranuide |
| SMILES | CC1(C)[C@H]2CC[C@H](C[N+]3=Cc4ccccc4CC3)[C@@H]1C2.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C19H26N/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-19(2)17-8-7-16(18(19)11-17)13-20-10-9-14-5-3-4-6-15(14)12-20/h1-20H;3-6,12,16-18H,7-11,13H2,1-2H3/q-1;+1/t;16-,17+,18+/m.1/s1 |
| InChIKey | XIYYVHMDPZYINB-JNJWJPDKSA-N |
| XLogP | 6.81 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.66 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|