C11H15N2+ — CID 129285200
2-(3,4-dihydroisoquinolin-2-ium-2-yl)ethanamine (PubChem CID 129285200) has the molecular formula C11H15N2+ and a molecular weight of 175.26 g/mol. Its IUPAC name is 2-(3,4-dihydroisoquinolin-2-ium-2-yl)ethanamine.
| Compound Name | 2-(3,4-dihydroisoquinolin-2-ium-2-yl)ethanamine |
|---|---|
| PubChem CID | 129285200 |
| Molecular Formula | C11H15N2+ |
| Molecular Weight | 175.26 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 2-(3,4-dihydroisoquinolin-2-ium-2-yl)ethanamine |
| SMILES | NCC[N+]1=Cc2ccccc2CC1 |
| InChI | InChI=1S/C11H15N2/c12-6-8-13-7-5-10-3-1-2-4-11(10)9-13/h1-4,9H,5-8,12H2/q+1 |
| InChIKey | MSEPKUQCDPLVLO-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 29.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.26 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|