C13H16F2N2 — CID 141439739
N-[2-[(3S)-3,4-dihydroisoquinolin-3-yl]ethyl]-2,2-difluoroethanamine (PubChem CID 141439739) has the molecular formula C13H16F2N2 and a molecular weight of 238.28 g/mol. Its IUPAC name is N-[2-[(3S)-3,4-dihydroisoquinolin-3-yl]ethyl]-2,2-difluoroethanamine.
| Compound Name | N-[2-[(3S)-3,4-dihydroisoquinolin-3-yl]ethyl]-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 141439739 |
| Molecular Formula | C13H16F2N2 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | N-[2-[(3S)-3,4-dihydroisoquinolin-3-yl]ethyl]-2,2-difluoroethanamine |
| SMILES | FC(F)CNCC[C@@H]1Cc2ccccc2C=N1 |
| InChI | InChI=1S/C13H16F2N2/c14-13(15)9-16-6-5-12-7-10-3-1-2-4-11(10)8-17-12/h1-4,8,12-13,16H,5-7,9H2/t12-/m1/s1 |
| InChIKey | XBGSYLAUKWVVIT-GFCCVEGCSA-N |
| XLogP | 2.28 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|