C18H20N2 — CID 3068618
N-methyl-2-(1-phenyl-3,4-dihydroisoquinolin-3-yl)ethanamine (PubChem CID 3068618) has the molecular formula C18H20N2 and a molecular weight of 264.37 g/mol. Its IUPAC name is N-methyl-2-(1-phenyl-3,4-dihydroisoquinolin-3-yl)ethanamine.
| Compound Name | N-methyl-2-(1-phenyl-3,4-dihydroisoquinolin-3-yl)ethanamine |
|---|---|
| PubChem CID | 3068618 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | N-methyl-2-(1-phenyl-3,4-dihydroisoquinolin-3-yl)ethanamine |
| SMILES | CNCCC1Cc2ccccc2C(c2ccccc2)=N1 |
| InChI | InChI=1S/C18H20N2/c1-19-12-11-16-13-15-9-5-6-10-17(15)18(20-16)14-7-3-2-4-8-14/h2-10,16,19H,11-13H2,1H3 |
| InChIKey | TWDAUOYNEIAKBF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |