About 1-benzyl-3,4-dihydroisoquinoline;hydrochloride
1-benzyl-3,4-dihydroisoquinoline;hydrochloride (PubChem CID 45048805) has the molecular formula C16H16ClN
and a molecular weight of 257.76 g/mol. Its IUPAC name is 1-benzyl-3,4-dihydroisoquinoline;hydrochloride.
Molecular Properties
| Compound Name | 1-benzyl-3,4-dihydroisoquinoline;hydrochloride |
| PubChem CID | 45048805 |
| Molecular Formula | C16H16ClN |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 1-benzyl-3,4-dihydroisoquinoline;hydrochloride |
| SMILES | Cl.c1ccc(CC2=NCCc3ccccc32)cc1 |
| InChI | InChI=1S/C16H15N.ClH/c1-2-6-13(7-3-1)12-16-15-9-5-4-8-14(15)10-11-17-16;/h1-9H,10-12H2;1H |
| InChIKey | WQQZXCXGKCQGFU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-benzyl-3,4-dihydroisoquinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3,4-dihydroisoquinoline;hydrochloride?
The IUPAC name of 1-benzyl-3,4-dihydroisoquinoline;hydrochloride (CID 45048805) is 1-benzyl-3,4-dihydroisoquinoline;hydrochloride.
What is the SMILES notation for 1-benzyl-3,4-dihydroisoquinoline;hydrochloride?
The canonical SMILES for 1-benzyl-3,4-dihydroisoquinoline;hydrochloride is Cl.c1ccc(CC2=NCCc3ccccc32)cc1.
What is the InChIKey of 1-benzyl-3,4-dihydroisoquinoline;hydrochloride?
The InChIKey is WQQZXCXGKCQGFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N.ClH/c1-2-6-13(7-3-1)12-16-15-9-5-4-8-14(15)10-11-17-16;/h1-9H,10-12H2;1H.
What are the key properties of 1-benzyl-3,4-dihydroisoquinoline;hydrochloride?
1-benzyl-3,4-dihydroisoquinoline;hydrochloride has a molecular weight of 257.76 g/mol, XLogP of 3.70, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3,4-dihydroisoquinoline;hydrochloride is sourced from PubChem (CID 45048805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).