C42H72P2 — CID 11115034
2-[bis[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]phosphanyl]ethyl-bis[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]phosphane (PubChem CID 11115034) has the molecular formula C42H72P2 and a molecular weight of 638.99 g/mol. Its IUPAC name is 2-[bis[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]phosphanyl]ethyl-bis[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]phosphane.
| Compound Name | 2-[bis[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]phosphanyl]ethyl-bis[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]phosphane |
|---|---|
| PubChem CID | 11115034 |
| Molecular Formula | C42H72P2 |
| Molecular Weight | 638.99 g/mol |
| Exact Mass | 638.51 |
| IUPAC Name | 2-[bis[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]phosphanyl]ethyl-bis[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]phosphane |
| SMILES | CC1(C)[C@H]2CC[C@@H](CP(CCP(C[C@@H]3CC[C@H]4C[C@@H]3C4(C)C)C[C@@H]3CC[C@H]4C[C@@H]3C4(C)C)C[C@@H]3CC[C@H]4C[C@@H]3C4(C)C)[C@@H]1C2 |
| InChI | InChI=1S/C42H72P2/c1-39(2)31-13-9-27(35(39)19-31)23-43(24-28-10-14-32-20-36(28)40(32,3)4)17-18-44(25-29-11-15-33-21-37(29)41(33,5)6)26-30-12-16-34-22-38(30)42(34,7)8/h27-38H,9-26H2,1-8H3/t27-,28-,29-,30-,31-,32-,33-,34-,35-,36-,37-,38-/m0/s1 |
| InChIKey | ZGSZTIOGZGXXJF-MGPCTGKMSA-N |
| XLogP | 12.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.99 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|