C17H34N+ — CID 90645928
2-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)ethyl-triethylazanium (PubChem CID 90645928) has the molecular formula C17H34N+ and a molecular weight of 252.47 g/mol. Its IUPAC name is 2-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)ethyl-triethylazanium.
| Compound Name | 2-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)ethyl-triethylazanium |
|---|---|
| PubChem CID | 90645928 |
| Molecular Formula | C17H34N+ |
| Molecular Weight | 252.47 g/mol |
| Exact Mass | 252.27 |
| IUPAC Name | 2-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)ethyl-triethylazanium |
| SMILES | CC[N+](CC)(CC)CCC1CCC2CC1C2(C)C |
| InChI | InChI=1S/C17H34N/c1-6-18(7-2,8-3)12-11-14-9-10-15-13-16(14)17(15,4)5/h14-16H,6-13H2,1-5H3/q+1 |
| InChIKey | UNKFXSAZBNJPDR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|