About 1-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)pentan-3-one
1-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)pentan-3-one (PubChem CID 21424309) has the molecular formula C14H24O
and a molecular weight of 208.34 g/mol. Its IUPAC name is 1-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)pentan-3-one.
Analyze 1-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)pentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)pentan-3-one?
The IUPAC name of 1-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)pentan-3-one (CID 21424309) is 1-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)pentan-3-one.
What is the SMILES notation for 1-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)pentan-3-one?
The canonical SMILES for 1-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)pentan-3-one is CCC(=O)CCC1CCC2CC1C2(C)C.
What is the InChIKey of 1-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)pentan-3-one?
The InChIKey is WRCCRBFEHMSCNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O/c1-4-12(15)8-6-10-5-7-11-9-13(10)14(11,2)3/h10-11,13H,4-9H2,1-3H3.
What are the key properties of 1-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)pentan-3-one?
1-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)pentan-3-one has a molecular weight of 208.34 g/mol, XLogP of 3.82, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)pentan-3-one is sourced from PubChem (CID 21424309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).